C29H30N6O2 — CID 170021587
N-[(1S)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxo-1-spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-ylethyl]-2-methyl-1,2,4-triazole-3-carboxamide (PubChem CID 170021587) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[(1S)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxo-1-spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-ylethyl]-2-methyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(1S)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxo-1-spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-ylethyl]-2-methyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 170021587 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[(1S)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxo-1-spiro[1,3-dihydroindene-2,1'-cyclopropane]-1-ylethyl]-2-methyl-1,2,4-triazole-3-carboxamide |
| SMILES | CC1=NCC(C)=C1c1ccc(NC(=O)[C@@H](NC(=O)c2ncnn2C)C2c3ccccc3CC23CC3)cc1 |
| InChI | InChI=1S/C29H30N6O2/c1-17-15-30-18(2)23(17)19-8-10-21(11-9-19)33-27(36)25(34-28(37)26-31-16-32-35(26)3)24-22-7-5-4-6-20(22)14-29(24)12-13-29/h4-11,16,24-25H,12-15H2,1-3H3,(H,33,36)(H,34,37)/t24?,25-/m0/s1 |
| InChIKey | FNIUKRJUADVISJ-BBMPLOMVSA-N |
| XLogP | 3.92 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |