C34H53N3 — CID 170021606
(3E,6Z)-8-cyclobutylidene-5-N,2,3-trimethyl-6-N-[(5Z,7E)-3-methyl-7-[(3S)-3-(2-methylpropyl)pyrrolidin-1-yl]nona-5,7-dien-4-ylidene]nona-1,3,6-triene-5,6-diimine (PubChem CID 170021606) has the molecular formula C34H53N3 and a molecular weight of 503.80 g/mol. Its IUPAC name is (3E,6Z)-8-cyclobutylidene-5-N,2,3-trimethyl-6-N-[(5Z,7E)-3-methyl-7-[(3S)-3-(2-methylpropyl)pyrrolidin-1-yl]nona-5,7-dien-4-ylidene]nona-1,3,6-triene-5,6-diimine.
| Compound Name | (3E,6Z)-8-cyclobutylidene-5-N,2,3-trimethyl-6-N-[(5Z,7E)-3-methyl-7-[(3S)-3-(2-methylpropyl)pyrrolidin-1-yl]nona-5,7-dien-4-ylidene]nona-1,3,6-triene-5,6-diimine |
|---|---|
| PubChem CID | 170021606 |
| Molecular Formula | C34H53N3 |
| Molecular Weight | 503.80 g/mol |
| Exact Mass | 503.42 |
| IUPAC Name | (3E,6Z)-8-cyclobutylidene-5-N,2,3-trimethyl-6-N-[(5Z,7E)-3-methyl-7-[(3S)-3-(2-methylpropyl)pyrrolidin-1-yl]nona-5,7-dien-4-ylidene]nona-1,3,6-triene-5,6-diimine |
| SMILES | CCC(C)C(=N/C(=C\C(=C1CCC1)C)/C(=NC)/C=C(\C)/C(=C)C)/C=C\C(=C/C)\N2CC[C@@H](C2)CC(C)C |
| InChI | InChI=1S/C34H53N3/c1-11-26(7)32(17-16-31(12-2)37-19-18-29(23-37)20-24(3)4)36-34(22-28(9)30-14-13-15-30)33(35-10)21-27(8)25(5)6/h12,16-17,21-22,24,26,29H,5,11,13-15,18-20,23H2,1-4,6-10H3/b17-16-,27-21+,31-12+,34-22-,35-33?,36-32?/t26?,29-/m1/s1 |
| InChIKey | MYQDKLRSOQYZCG-SJBGSJMDSA-N |
| XLogP | 9.70 |
| TPSA | 28.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | 1000 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.80 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|