C32H30F2N4O4 — CID 170021720
3-cyclopropyl-N-[(1S)-1-(6,7-difluorospiro[2,4-dihydrochromene-3,1'-cyclopropane]-4-yl)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxoethyl]-1,2-oxazole-4-carboxamide (PubChem CID 170021720) has the molecular formula C32H30F2N4O4 and a molecular weight of 572.61 g/mol. Its IUPAC name is 3-cyclopropyl-N-[(1S)-1-(6,7-difluorospiro[2,4-dihydrochromene-3,1'-cyclopropane]-4-yl)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxoethyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-cyclopropyl-N-[(1S)-1-(6,7-difluorospiro[2,4-dihydrochromene-3,1'-cyclopropane]-4-yl)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxoethyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 170021720 |
| Molecular Formula | C32H30F2N4O4 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 3-cyclopropyl-N-[(1S)-1-(6,7-difluorospiro[2,4-dihydrochromene-3,1'-cyclopropane]-4-yl)-2-[4-(3,5-dimethyl-2H-pyrrol-4-yl)anilino]-2-oxoethyl]-1,2-oxazole-4-carboxamide |
| SMILES | CC1=NCC(C)=C1c1ccc(NC(=O)[C@@H](NC(=O)c2conc2C2CC2)C2c3cc(F)c(F)cc3OCC23CC3)cc1 |
| InChI | InChI=1S/C32H30F2N4O4/c1-16-13-35-17(2)26(16)18-5-7-20(8-6-18)36-31(40)29(37-30(39)22-14-42-38-28(22)19-3-4-19)27-21-11-23(33)24(34)12-25(21)41-15-32(27)9-10-32/h5-8,11-12,14,19,27,29H,3-4,9-10,13,15H2,1-2H3,(H,36,40)(H,37,39)/t27?,29-/m0/s1 |
| InChIKey | LTDJMORMSIMCJC-ACEFPKFPSA-N |
| XLogP | 5.77 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |