C17H16N4O3S — CID 170021862
(2E,4E)-2-ethenyl-5-[2-(5-methylsulfonyl-2-pyridinyl)-3-oxo-1H-pyrazol-4-yl]hexa-2,4-dienenitrile (PubChem CID 170021862) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-[2-(5-methylsulfonyl-2-pyridinyl)-3-oxo-1H-pyrazol-4-yl]hexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-2-ethenyl-5-[2-(5-methylsulfonyl-2-pyridinyl)-3-oxo-1H-pyrazol-4-yl]hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 170021862 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-[2-(5-methylsulfonyl-2-pyridinyl)-3-oxo-1H-pyrazol-4-yl]hexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C=C(/C)c1c[nH]n(-c2ccc(S(C)(=O)=O)cn2)c1=O |
| InChI | InChI=1S/C17H16N4O3S/c1-4-13(9-18)6-5-12(2)15-11-20-21(17(15)22)16-8-7-14(10-19-16)25(3,23)24/h4-8,10-11,20H,1H2,2-3H3/b12-5+,13-6+ |
| InChIKey | ASJZXFYFCZIZNP-BYDSPXIWSA-N |
| XLogP | 2.00 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|