C21H20N4 — CID 170022006
6-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8-pyrrolidin-2-ylquinoline (PubChem CID 170022006) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8-pyrrolidin-2-ylquinoline.
| Compound Name | 6-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8-pyrrolidin-2-ylquinoline |
|---|---|
| PubChem CID | 170022006 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 6-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-8-pyrrolidin-2-ylquinoline |
| SMILES | Cc1c[nH]c2ncc(-c3cc(C4CCCN4)c4ncccc4c3)cc12 |
| InChI | InChI=1S/C21H20N4/c1-13-11-24-21-17(13)10-16(12-25-21)15-8-14-4-2-7-23-20(14)18(9-15)19-5-3-6-22-19/h2,4,7-12,19,22H,3,5-6H2,1H3,(H,24,25) |
| InChIKey | CEIFNRLHNISAEX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |