C20H21N3O2 — CID 170022173
5-ethynyl-2-[4-[[(3R)-oxolan-3-yl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol (PubChem CID 170022173) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-ethynyl-2-[4-[[(3R)-oxolan-3-yl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol.
| Compound Name | 5-ethynyl-2-[4-[[(3R)-oxolan-3-yl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 170022173 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-ethynyl-2-[4-[[(3R)-oxolan-3-yl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCOC3)c3c2CCCC3)c(O)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-2-13-7-8-17(18(24)11-13)19-15-5-3-4-6-16(15)20(23-22-19)21-14-9-10-25-12-14/h1,7-8,11,14,24H,3-6,9-10,12H2,(H,21,23)/t14-/m1/s1 |
| InChIKey | GCVBIFGBGDJATB-CQSZACIVSA-N |
| XLogP | 2.91 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|