C22H25N3O2 — CID 170022176
5-ethynyl-2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol (PubChem CID 170022176) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-ethynyl-2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol.
| Compound Name | 5-ethynyl-2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 170022176 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-ethynyl-2-[4-[[(1S,2S)-2-hydroxycyclohexyl]amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@H]3CCCC[C@@H]3O)c3c2CCCC3)c(O)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-2-14-11-12-17(20(27)13-14)21-15-7-3-4-8-16(15)22(25-24-21)23-18-9-5-6-10-19(18)26/h1,11-13,18-19,26-27H,3-10H2,(H,23,25)/t18-,19-/m0/s1 |
| InChIKey | SBTDHFSMILPWKT-OALUTQOASA-N |
| XLogP | 3.42 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|