About 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol
5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol (PubChem CID 170022472) has the molecular formula C21H19F2N3O2
and a molecular weight of 383.40 g/mol. Its IUPAC name is 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol |
| PubChem CID | 170022472 |
| Molecular Formula | C21H19F2N3O2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol |
| SMILES | CC1(O)CC(Nc2nnc(-c3ccc(C=C(F)F)cc3O)c3ccccc23)C1 |
| InChI | InChI=1S/C21H19F2N3O2/c1-21(28)10-13(11-21)24-20-15-5-3-2-4-14(15)19(25-26-20)16-7-6-12(8-17(16)27)9-18(22)23/h2-9,13,27-28H,10-11H2,1H3,(H,24,26) |
| InChIKey | WMUSTTLGTRHNAB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol?
The IUPAC name of 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol (CID 170022472) is 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol.
What is the SMILES notation for 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol?
The canonical SMILES for 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol is CC1(O)CC(Nc2nnc(-c3ccc(C=C(F)F)cc3O)c3ccccc23)C1.
What is the InChIKey of 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol?
The InChIKey is WMUSTTLGTRHNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N3O2/c1-21(28)10-13(11-21)24-20-15-5-3-2-4-14(15)19(25-26-20)16-7-6-12(8-17(16)27)9-18(22)23/h2-9,13,27-28H,10-11H2,1H3,(H,24,26).
What are the key properties of 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol?
5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol has a molecular weight of 383.40 g/mol, XLogP of 4.57, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethenyl)-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol is sourced from PubChem (CID 170022472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).