C18H21N5O2 — CID 170022767
5-ethynyl-2-[5-methoxy-3-[(1-methylpiperidin-3-yl)amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 170022767) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-ethynyl-2-[5-methoxy-3-[(1-methylpiperidin-3-yl)amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-ethynyl-2-[5-methoxy-3-[(1-methylpiperidin-3-yl)amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 170022767 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 5-ethynyl-2-[5-methoxy-3-[(1-methylpiperidin-3-yl)amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(NC3CCCN(C)C3)nc2OC)c(O)c1 |
| InChI | InChI=1S/C18H21N5O2/c1-4-12-7-8-14(15(24)10-12)16-17(25-3)20-18(22-21-16)19-13-6-5-9-23(2)11-13/h1,7-8,10,13,24H,5-6,9,11H2,2-3H3,(H,19,20,22) |
| InChIKey | NOBWHSMWNMDDLA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|