C51H35N5 — CID 170023088
(4aR)-12-(3-phenylphenyl)-11-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-4a,12a-dihydroindolo[2,3-a]carbazole (PubChem CID 170023088) has the molecular formula C51H35N5 and a molecular weight of 717.88 g/mol. Its IUPAC name is (4aR)-12-(3-phenylphenyl)-11-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-4a,12a-dihydroindolo[2,3-a]carbazole.
| Compound Name | (4aR)-12-(3-phenylphenyl)-11-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-4a,12a-dihydroindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 170023088 |
| Molecular Formula | C51H35N5 |
| Molecular Weight | 717.88 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | (4aR)-12-(3-phenylphenyl)-11-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-4a,12a-dihydroindolo[2,3-a]carbazole |
| SMILES | C1=CC2[C@H](C=C1)c1ccc3c4ccccc4n(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3c1N2c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C51H35N5/c1-4-16-34(17-5-1)37-22-14-24-39(32-37)50-52-49(36-20-8-3-9-21-36)53-51(54-50)56-46-29-13-11-27-42(46)44-31-30-43-41-26-10-12-28-45(41)55(47(43)48(44)56)40-25-15-23-38(33-40)35-18-6-2-7-19-35/h1-33,41,45H/t41-,45?/m1/s1 |
| InChIKey | XOUDCAVVNCRFJR-UOWLFLJMSA-N |
| XLogP | 12.37 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.88 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |