C15H17N5O2 — CID 170023223
1-amino-N-(3-methoxypropyl)pyrazino[1,2-a]benzimidazole-3-carboxamide (PubChem CID 170023223) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-amino-N-(3-methoxypropyl)pyrazino[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | 1-amino-N-(3-methoxypropyl)pyrazino[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 170023223 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-amino-N-(3-methoxypropyl)pyrazino[1,2-a]benzimidazole-3-carboxamide |
| SMILES | COCCCNC(=O)c1cn2c(nc3ccccc32)c(N)n1 |
| InChI | InChI=1S/C15H17N5O2/c1-22-8-4-7-17-15(21)11-9-20-12-6-3-2-5-10(12)19-14(20)13(16)18-11/h2-3,5-6,9H,4,7-8H2,1H3,(H2,16,18)(H,17,21) |
| InChIKey | JTHWUGMICGEMQI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|