About 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine
2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine (PubChem CID 170023943) has the molecular formula C10H16ClN
and a molecular weight of 185.70 g/mol. Its IUPAC name is 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine |
| PubChem CID | 170023943 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine |
| SMILES | CN(C)CC(Cl)C1=CCCC=C1 |
| InChI | InChI=1S/C10H16ClN/c1-12(2)8-10(11)9-6-4-3-5-7-9/h4,6-7,10H,3,5,8H2,1-2H3 |
| InChIKey | VEAOZABTDBVXKH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine?
The IUPAC name of 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine (CID 170023943) is 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine.
What is the SMILES notation for 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine?
The canonical SMILES for 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine is CN(C)CC(Cl)C1=CCCC=C1.
What is the InChIKey of 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine?
The InChIKey is VEAOZABTDBVXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN/c1-12(2)8-10(11)9-6-4-3-5-7-9/h4,6-7,10H,3,5,8H2,1-2H3.
What are the key properties of 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine?
2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine has a molecular weight of 185.70 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-cyclohexa-1,5-dien-1-yl-N,N-dimethylethanamine is sourced from PubChem (CID 170023943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).