C15H16N4O3 — CID 170024201
1-[7-methyl-1-(oxetan-3-yl)indazol-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 170024201) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 1-[7-methyl-1-(oxetan-3-yl)indazol-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[7-methyl-1-(oxetan-3-yl)indazol-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 170024201 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[7-methyl-1-(oxetan-3-yl)indazol-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | Cc1cccc2c(N3CCC(=O)NC3=O)nn(C3COC3)c12 |
| InChI | InChI=1S/C15H16N4O3/c1-9-3-2-4-11-13(9)19(10-7-22-8-10)17-14(11)18-6-5-12(20)16-15(18)21/h2-4,10H,5-8H2,1H3,(H,16,20,21) |
| InChIKey | YSYKFZLJNMJWCF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |