C38H43N9O5 — CID 170024647
3-[4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-2-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide (PubChem CID 170024647) has the molecular formula C38H43N9O5 and a molecular weight of 705.82 g/mol. Its IUPAC name is 3-[4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-2-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide.
| Compound Name | 3-[4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-2-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 170024647 |
| Molecular Formula | C38H43N9O5 |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.34 |
| IUPAC Name | 3-[4-[7-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]methyl]-1,3,4,4a,5,6,8,8a-octahydro-2,7-naphthyridin-2-yl]anilino]-5-piperidin-1-ylpyrazine-2-carboxamide |
| SMILES | NC(=O)c1ncc(N2CCCCC2)nc1Nc1ccc(N2CCC3CCN(Cc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3C2)cc1 |
| InChI | InChI=1S/C38H43N9O5/c39-34(49)33-35(42-31(19-40-33)45-14-2-1-3-15-45)41-26-5-7-27(8-6-26)46-17-13-24-12-16-44(21-25(24)22-46)20-23-4-9-28-29(18-23)38(52)47(37(28)51)30-10-11-32(48)43-36(30)50/h4-9,18-19,24-25,30H,1-3,10-17,20-22H2,(H2,39,49)(H,41,42)(H,43,48,50) |
| InChIKey | KCBIAGZNSCGDSK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 174.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|