C15H24N2 — CID 170025166
N,N,2,5,6-pentamethyl-3-methylimino-4-propan-2-ylidenecyclohexa-1,5-dien-1-amine (PubChem CID 170025166) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N,N,2,5,6-pentamethyl-3-methylimino-4-propan-2-ylidenecyclohexa-1,5-dien-1-amine.
| Compound Name | N,N,2,5,6-pentamethyl-3-methylimino-4-propan-2-ylidenecyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 170025166 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N,N,2,5,6-pentamethyl-3-methylimino-4-propan-2-ylidenecyclohexa-1,5-dien-1-amine |
| SMILES | C/N=C1\C(C)=C(N(C)C)C(C)=C(C)C1=C(C)C |
| InChI | InChI=1S/C15H24N2/c1-9(2)13-10(3)11(4)15(17(7)8)12(5)14(13)16-6/h1-8H3/b16-14+ |
| InChIKey | BESLYFYKAFQXFB-JQIJEIRASA-N |
| XLogP | 3.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|