About 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine
4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine (PubChem CID 170025915) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine.
Molecular Properties
| Compound Name | 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine |
| PubChem CID | 170025915 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine |
| SMILES | C#Cc1ccc(-c2nnc(NC)c3sccc23)c(OCOCC)c1 |
| InChI | InChI=1S/C18H17N3O2S/c1-4-12-6-7-13(15(10-12)23-11-22-5-2)16-14-8-9-24-17(14)18(19-3)21-20-16/h1,6-10H,5,11H2,2-3H3,(H,19,21) |
| InChIKey | OHNSFYVLEOJKSW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine?
The IUPAC name of 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine (CID 170025915) is 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine.
What is the SMILES notation for 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine?
The canonical SMILES for 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine is C#Cc1ccc(-c2nnc(NC)c3sccc23)c(OCOCC)c1.
What is the InChIKey of 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine?
The InChIKey is OHNSFYVLEOJKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2S/c1-4-12-6-7-13(15(10-12)23-11-22-5-2)16-14-8-9-24-17(14)18(19-3)21-20-16/h1,6-10H,5,11H2,2-3H3,(H,19,21).
What are the key properties of 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine?
4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine has a molecular weight of 339.42 g/mol, XLogP of 3.75, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-methylthieno[2,3-d]pyridazin-7-amine is sourced from PubChem (CID 170025915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).