C50H39N3 — CID 170026216
(Z)-1-[3-[3,6-diphenyl-2-[3-[(Z)-4-phenylbut-2-enimidoyl]phenyl]phenyl]phenyl]-4-phenylbut-2-ene-1,4-diimine (PubChem CID 170026216) has the molecular formula C50H39N3 and a molecular weight of 681.88 g/mol. Its IUPAC name is (Z)-1-[3-[3,6-diphenyl-2-[3-[(Z)-4-phenylbut-2-enimidoyl]phenyl]phenyl]phenyl]-4-phenylbut-2-ene-1,4-diimine.
| Compound Name | (Z)-1-[3-[3,6-diphenyl-2-[3-[(Z)-4-phenylbut-2-enimidoyl]phenyl]phenyl]phenyl]-4-phenylbut-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 170026216 |
| Molecular Formula | C50H39N3 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | (Z)-1-[3-[3,6-diphenyl-2-[3-[(Z)-4-phenylbut-2-enimidoyl]phenyl]phenyl]phenyl]-4-phenylbut-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])c1cccc(-c2c(-c3ccccc3)ccc(-c3ccccc3)c2-c2cccc(C(/C=C\Cc3ccccc3)=N/[H])c2)c1)c1ccccc1 |
| InChI | InChI=1S/C50H39N3/c51-46(29-13-18-36-16-5-1-6-17-36)40-25-14-27-42(34-40)49-44(37-19-7-2-8-20-37)30-31-45(38-21-9-3-10-22-38)50(49)43-28-15-26-41(35-43)48(53)33-32-47(52)39-23-11-4-12-24-39/h1-17,19-35,51-53H,18H2/b29-13-,33-32-,51-46+,52-47-,53-48- |
| InChIKey | JNFOVGLIRMERDW-QVOAWDTASA-N |
| XLogP | 12.51 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|