C29H31N3O2 — CID 17002680
4-[1-[3-(4-ethylphenoxy)propyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one (PubChem CID 17002680) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 4-[1-[3-(4-ethylphenoxy)propyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[3-(4-ethylphenoxy)propyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17002680 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 4-[1-[3-(4-ethylphenoxy)propyl]benzimidazol-2-yl]-1-(2-methylphenyl)pyrrolidin-2-one |
| SMILES | CCc1ccc(OCCCn2c(C3CC(=O)N(c4ccccc4C)C3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H31N3O2/c1-3-22-13-15-24(16-14-22)34-18-8-17-31-27-12-7-5-10-25(27)30-29(31)23-19-28(33)32(20-23)26-11-6-4-9-21(26)2/h4-7,9-16,23H,3,8,17-20H2,1-2H3 |
| InChIKey | ULEHLXUOELUIMD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|