C11H7BrF3NO2 — CID 170026804
methyl 5-bromo-4,6,7-trifluoro-1-methylindole-2-carboxylate (PubChem CID 170026804) has the molecular formula C11H7BrF3NO2 and a molecular weight of 322.08 g/mol. Its IUPAC name is methyl 5-bromo-4,6,7-trifluoro-1-methylindole-2-carboxylate.
| Compound Name | methyl 5-bromo-4,6,7-trifluoro-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 170026804 |
| Molecular Formula | C11H7BrF3NO2 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | methyl 5-bromo-4,6,7-trifluoro-1-methylindole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(F)c(Br)c(F)c(F)c2n1C |
| InChI | InChI=1S/C11H7BrF3NO2/c1-16-5(11(17)18-2)3-4-7(13)6(12)8(14)9(15)10(4)16/h3H,1-2H3 |
| InChIKey | LUQWPAYDUZCLOQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|