C21H20N4O4 — CID 170027061
[3-[5-(1-cyclopentylbenzimidazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methanetriol (PubChem CID 170027061) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is [3-[5-(1-cyclopentylbenzimidazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methanetriol.
| Compound Name | [3-[5-(1-cyclopentylbenzimidazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methanetriol |
|---|---|
| PubChem CID | 170027061 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [3-[5-(1-cyclopentylbenzimidazol-5-yl)-1,2,4-oxadiazol-3-yl]phenyl]methanetriol |
| SMILES | OC(O)(O)c1cccc(-c2noc(-c3ccc4c(c3)ncn4C3CCCC3)n2)c1 |
| InChI | InChI=1S/C21H20N4O4/c26-21(27,28)15-5-3-4-13(10-15)19-23-20(29-24-19)14-8-9-18-17(11-14)22-12-25(18)16-6-1-2-7-16/h3-5,8-12,16,26-28H,1-2,6-7H2 |
| InChIKey | UXRZWICBHVEEDA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|