About 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone
1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone (PubChem CID 170027239) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone |
| PubChem CID | 170027239 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone |
| SMILES | COc1nnc2c(c1C(C)=O)CCCC2 |
| InChI | InChI=1S/C11H14N2O2/c1-7(14)10-8-5-3-4-6-9(8)12-13-11(10)15-2/h3-6H2,1-2H3 |
| InChIKey | GHWIKJGZPDKPBS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone?
The IUPAC name of 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone (CID 170027239) is 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone.
What is the SMILES notation for 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone?
The canonical SMILES for 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone is COc1nnc2c(c1C(C)=O)CCCC2.
What is the InChIKey of 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone?
The InChIKey is GHWIKJGZPDKPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-7(14)10-8-5-3-4-6-9(8)12-13-11(10)15-2/h3-6H2,1-2H3.
What are the key properties of 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone?
1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone has a molecular weight of 206.24 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxy-5,6,7,8-tetrahydrocinnolin-4-yl)ethanone is sourced from PubChem (CID 170027239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).