C15H14N4O — CID 170027269
2-(4-amino-5,6,7,8-tetrahydrophthalazin-1-yl)-5-ethynylpyridin-3-ol (PubChem CID 170027269) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-amino-5,6,7,8-tetrahydrophthalazin-1-yl)-5-ethynylpyridin-3-ol.
| Compound Name | 2-(4-amino-5,6,7,8-tetrahydrophthalazin-1-yl)-5-ethynylpyridin-3-ol |
|---|---|
| PubChem CID | 170027269 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(4-amino-5,6,7,8-tetrahydrophthalazin-1-yl)-5-ethynylpyridin-3-ol |
| SMILES | C#Cc1cnc(-c2nnc(N)c3c2CCCC3)c(O)c1 |
| InChI | InChI=1S/C15H14N4O/c1-2-9-7-12(20)14(17-8-9)13-10-5-3-4-6-11(10)15(16)19-18-13/h1,7-8,20H,3-6H2,(H2,16,19) |
| InChIKey | HSSOCGLPYVXBKO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|