C18H20N4O2 — CID 170027429
5-ethynyl-2-[3-[(3-methoxy-3-methylcyclobutyl)amino]-5-methyl-1,2,4-triazin-6-yl]phenol (PubChem CID 170027429) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-ethynyl-2-[3-[(3-methoxy-3-methylcyclobutyl)amino]-5-methyl-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-ethynyl-2-[3-[(3-methoxy-3-methylcyclobutyl)amino]-5-methyl-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 170027429 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 5-ethynyl-2-[3-[(3-methoxy-3-methylcyclobutyl)amino]-5-methyl-1,2,4-triazin-6-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(NC3CC(C)(OC)C3)nc2C)c(O)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-5-12-6-7-14(15(23)8-12)16-11(2)19-17(22-21-16)20-13-9-18(3,10-13)24-4/h1,6-8,13,23H,9-10H2,2-4H3,(H,19,20,22) |
| InChIKey | WAWCWFJQROEOBK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|