About [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate
[(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate (PubChem CID 170027903) has the molecular formula C14H20FIN6O3
and a molecular weight of 466.26 g/mol. Its IUPAC name is [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate.
Molecular Properties
| Compound Name | [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate |
| PubChem CID | 170027903 |
| Molecular Formula | C14H20FIN6O3 |
| Molecular Weight | 466.26 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate |
| SMILES | CNc1nc(F)nc2c1ncn2CC[C@@](C)(COC(=O)N(C)I)OC |
| InChI | InChI=1S/C14H20FIN6O3/c1-14(24-4,7-25-13(23)21(3)16)5-6-22-8-18-9-10(17-2)19-12(15)20-11(9)22/h8H,5-7H2,1-4H3,(H,17,19,20)/t14-/m0/s1 |
| InChIKey | DHTBXHLTZCXPHU-AWEZNQCLSA-N |
| XLogP | 2.22 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate?
The IUPAC name of [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate (CID 170027903) is [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate.
What is the SMILES notation for [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate?
The canonical SMILES for [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate is CNc1nc(F)nc2c1ncn2CC[C@@](C)(COC(=O)N(C)I)OC.
What is the InChIKey of [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate?
The InChIKey is DHTBXHLTZCXPHU-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H20FIN6O3/c1-14(24-4,7-25-13(23)21(3)16)5-6-22-8-18-9-10(17-2)19-12(15)20-11(9)22/h8H,5-7H2,1-4H3,(H,17,19,20)/t14-/m0/s1.
What are the key properties of [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate?
[(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate has a molecular weight of 466.26 g/mol, XLogP of 2.22, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-4-[2-fluoro-6-(methylamino)purin-9-yl]-2-methoxy-2-methylbutyl] N-iodo-N-methylcarbamate is sourced from PubChem (CID 170027903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).