C40H26N4O — CID 170027959
2-[3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole (PubChem CID 170027959) has the molecular formula C40H26N4O and a molecular weight of 578.68 g/mol. Its IUPAC name is 2-[3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 170027959 |
| Molecular Formula | C40H26N4O |
| Molecular Weight | 578.68 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 2-[3-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3-c3ccc(-c4cccc(-c5nc6ccccc6o5)c4)cc3)n2)cc1 |
| InChI | InChI=1S/C40H26N4O/c1-3-12-29(13-4-1)37-42-38(30-14-5-2-6-15-30)44-39(43-37)34-19-8-7-18-33(34)28-24-22-27(23-25-28)31-16-11-17-32(26-31)40-41-35-20-9-10-21-36(35)45-40/h1-26H |
| InChIKey | VGVQIKFEZFYFSV-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.68 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |