About N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide
N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide (PubChem CID 170028238) has the molecular formula C17H17ClN4O2
and a molecular weight of 344.80 g/mol. Its IUPAC name is N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide.
Molecular Properties
| Compound Name | N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide |
| PubChem CID | 170028238 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide |
| SMILES | CC(C)CN(N=O)c1ccc(-c2nc3c(Cl)cccc3o2)cc1N |
| InChI | InChI=1S/C17H17ClN4O2/c1-10(2)9-22(21-23)14-7-6-11(8-13(14)19)17-20-16-12(18)4-3-5-15(16)24-17/h3-8,10H,9,19H2,1-2H3 |
| InChIKey | OHLAAYFDDZHNAW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide?
The IUPAC name of N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide (CID 170028238) is N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide.
What is the SMILES notation for N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide?
The canonical SMILES for N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide is CC(C)CN(N=O)c1ccc(-c2nc3c(Cl)cccc3o2)cc1N.
What is the InChIKey of N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide?
The InChIKey is OHLAAYFDDZHNAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4O2/c1-10(2)9-22(21-23)14-7-6-11(8-13(14)19)17-20-16-12(18)4-3-5-15(16)24-17/h3-8,10H,9,19H2,1-2H3.
What are the key properties of N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide?
N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide has a molecular weight of 344.80 g/mol, XLogP of 4.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-amino-4-(4-chloro-1,3-benzoxazol-2-yl)phenyl]-N-(2-methylpropyl)nitrous amide is sourced from PubChem (CID 170028238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).