C24H24FN3O — CID 170028740
(2E,4E)-5-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N,2,4-trimethylhepta-2,4,6-trienamide (PubChem CID 170028740) has the molecular formula C24H24FN3O and a molecular weight of 389.47 g/mol. Its IUPAC name is (2E,4E)-5-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N,2,4-trimethylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-5-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N,2,4-trimethylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 170028740 |
| Molecular Formula | C24H24FN3O |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (2E,4E)-5-(3-fluorophenyl)-N-(1H-indazol-7-ylmethyl)-N,2,4-trimethylhepta-2,4,6-trienamide |
| SMILES | C=C/C(=C(C)\C=C(/C)C(=O)N(C)Cc1cccc2cn[nH]c12)c1cccc(F)c1 |
| InChI | InChI=1S/C24H24FN3O/c1-5-22(18-8-7-11-21(25)13-18)16(2)12-17(3)24(29)28(4)15-20-10-6-9-19-14-26-27-23(19)20/h5-14H,1,15H2,2-4H3,(H,26,27)/b17-12+,22-16+ |
| InChIKey | VGKUAWNDRFYGGB-SIUKEETGSA-N |
| XLogP | 5.27 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|