C30H33N3O2 — CID 17002914
4-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-(2,4-dimethylphenyl)pyrrolidin-2-one (PubChem CID 17002914) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-(2,4-dimethylphenyl)pyrrolidin-2-one.
| Compound Name | 4-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-(2,4-dimethylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 17002914 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-[1-[3-(3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]-1-(2,4-dimethylphenyl)pyrrolidin-2-one |
| SMILES | Cc1cc(C)cc(OCCCn2c(C3CC(=O)N(c4ccc(C)cc4C)C3)nc3ccccc32)c1 |
| InChI | InChI=1S/C30H33N3O2/c1-20-10-11-27(23(4)15-20)33-19-24(18-29(33)34)30-31-26-8-5-6-9-28(26)32(30)12-7-13-35-25-16-21(2)14-22(3)17-25/h5-6,8-11,14-17,24H,7,12-13,18-19H2,1-4H3 |
| InChIKey | SSVUHPIERHVFAJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|