C18H31N — CID 170029250
(1S)-N-but-3-en-2-yl-2,4,7,7-tetramethyl-N-propylcyclohepta-2,4-dien-1-amine (PubChem CID 170029250) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (1S)-N-but-3-en-2-yl-2,4,7,7-tetramethyl-N-propylcyclohepta-2,4-dien-1-amine.
| Compound Name | (1S)-N-but-3-en-2-yl-2,4,7,7-tetramethyl-N-propylcyclohepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 170029250 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (1S)-N-but-3-en-2-yl-2,4,7,7-tetramethyl-N-propylcyclohepta-2,4-dien-1-amine |
| SMILES | C=CC(C)N(CCC)[C@@H]1C(C)=CC(C)=CCC1(C)C |
| InChI | InChI=1S/C18H31N/c1-8-12-19(16(5)9-2)17-15(4)13-14(3)10-11-18(17,6)7/h9-10,13,16-17H,2,8,11-12H2,1,3-7H3/t16?,17-/m1/s1 |
| InChIKey | OFXCOAYHBLMNJW-ZYMOGRSISA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|