About 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine
6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine (PubChem CID 170029807) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine.
Molecular Properties
| Compound Name | 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine |
| PubChem CID | 170029807 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine |
| SMILES | C=CC1=C(/C=C\C)C(=C)C(C)(CCC)C(C)=N1 |
| InChI | InChI=1S/C16H23N/c1-7-10-14-12(4)16(6,11-8-2)13(5)17-15(14)9-3/h7,9-10H,3-4,8,11H2,1-2,5-6H3/b10-7- |
| InChIKey | NJFNQRHAKZBMKK-YFHOEESVSA-N |
| XLogP | 4.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine?
The IUPAC name of 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine (CID 170029807) is 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine.
What is the SMILES notation for 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine?
The canonical SMILES for 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine is C=CC1=C(/C=C\C)C(=C)C(C)(CCC)C(C)=N1.
What is the InChIKey of 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine?
The InChIKey is NJFNQRHAKZBMKK-YFHOEESVSA-N. The full InChI is InChI=1S/C16H23N/c1-7-10-14-12(4)16(6,11-8-2)13(5)17-15(14)9-3/h7,9-10H,3-4,8,11H2,1-2,5-6H3/b10-7-.
What are the key properties of 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine?
6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine has a molecular weight of 229.37 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,3-dimethyl-4-methylidene-5-[(Z)-prop-1-enyl]-3-propylpyridine is sourced from PubChem (CID 170029807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).