About N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide
N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide (PubChem CID 170029952) has the molecular formula C11H17N3O5
and a molecular weight of 271.27 g/mol. Its IUPAC name is N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide.
Molecular Properties
| Compound Name | N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide |
| PubChem CID | 170029952 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide |
| SMILES | CCC(=O)NCCNC(=O)NCc1oc(=O)oc1C |
| InChI | InChI=1S/C11H17N3O5/c1-3-9(15)12-4-5-13-10(16)14-6-8-7(2)18-11(17)19-8/h3-6H2,1-2H3,(H,12,15)(H2,13,14,16) |
| InChIKey | CRZHKUDCHMRJDF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide?
The IUPAC name of N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide (CID 170029952) is N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide.
What is the SMILES notation for N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide?
The canonical SMILES for N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide is CCC(=O)NCCNC(=O)NCc1oc(=O)oc1C.
What is the InChIKey of N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide?
The InChIKey is CRZHKUDCHMRJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O5/c1-3-9(15)12-4-5-13-10(16)14-6-8-7(2)18-11(17)19-8/h3-6H2,1-2H3,(H,12,15)(H2,13,14,16).
What are the key properties of N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide?
N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide has a molecular weight of 271.27 g/mol, XLogP of -0.13, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methylcarbamoylamino]ethyl]propanamide is sourced from PubChem (CID 170029952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).