C21H20Cl2N4O4 — CID 170030474
1,1-bis(chloromethyl)-3-[2-[(2,4-dioxo-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaen-3-yl)methylamino]ethyl]-3-methylurea (PubChem CID 170030474) has the molecular formula C21H20Cl2N4O4 and a molecular weight of 463.32 g/mol. Its IUPAC name is 1,1-bis(chloromethyl)-3-[2-[(2,4-dioxo-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaen-3-yl)methylamino]ethyl]-3-methylurea.
| Compound Name | 1,1-bis(chloromethyl)-3-[2-[(2,4-dioxo-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaen-3-yl)methylamino]ethyl]-3-methylurea |
|---|---|
| PubChem CID | 170030474 |
| Molecular Formula | C21H20Cl2N4O4 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 1,1-bis(chloromethyl)-3-[2-[(2,4-dioxo-11-oxa-3-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1(16),5,7,9,12,14-hexaen-3-yl)methylamino]ethyl]-3-methylurea |
| SMILES | CN(CCNCN1C(=O)c2cccc3c2c(cc2ccoc23)C1=O)C(=O)N(CCl)CCl |
| InChI | InChI=1S/C21H20Cl2N4O4/c1-25(21(30)26(10-22)11-23)7-6-24-12-27-19(28)15-4-2-3-14-17(15)16(20(27)29)9-13-5-8-31-18(13)14/h2-5,8-9,24H,6-7,10-12H2,1H3 |
| InChIKey | NKINBJPCYHLBMF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|