C20H28ClFN4O2 — CID 170030675
tert-butyl 4-[(1E,3Z)-1,2,4-triamino-4-(5-chloro-2-fluorophenyl)buta-1,3-dienyl]piperidine-1-carboxylate (PubChem CID 170030675) has the molecular formula C20H28ClFN4O2 and a molecular weight of 410.92 g/mol. Its IUPAC name is tert-butyl 4-[(1E,3Z)-1,2,4-triamino-4-(5-chloro-2-fluorophenyl)buta-1,3-dienyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1E,3Z)-1,2,4-triamino-4-(5-chloro-2-fluorophenyl)buta-1,3-dienyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170030675 |
| Molecular Formula | C20H28ClFN4O2 |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | tert-butyl 4-[(1E,3Z)-1,2,4-triamino-4-(5-chloro-2-fluorophenyl)buta-1,3-dienyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(/C(N)=C(N)/C=C(\N)c2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C20H28ClFN4O2/c1-20(2,3)28-19(27)26-8-6-12(7-9-26)18(25)17(24)11-16(23)14-10-13(21)4-5-15(14)22/h4-5,10-12H,6-9,23-25H2,1-3H3/b16-11-,18-17+ |
| InChIKey | HEFOLYYSVUWWIT-FBFUSSJBSA-N |
| XLogP | 3.55 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|