C21H26N4O4S — CID 170030685
tert-butyl (3aS,8aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-3a,4,6,7,8,8a-hexahydro-3H-imidazo[4,5-c]azepine-5-carboxylate (PubChem CID 170030685) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is tert-butyl (3aS,8aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-3a,4,6,7,8,8a-hexahydro-3H-imidazo[4,5-c]azepine-5-carboxylate.
| Compound Name | tert-butyl (3aS,8aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-3a,4,6,7,8,8a-hexahydro-3H-imidazo[4,5-c]azepine-5-carboxylate |
|---|---|
| PubChem CID | 170030685 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | tert-butyl (3aS,8aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-3a,4,6,7,8,8a-hexahydro-3H-imidazo[4,5-c]azepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]2[C@H](C1)NC(=O)N2c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C21H26N4O4S/c1-21(2,3)29-20(27)24-9-4-5-14-13(11-24)22-18(26)25(14)19-23-17-12-8-10-28-15(12)6-7-16(17)30-19/h6-7,13-14H,4-5,8-11H2,1-3H3,(H,22,26)/t13-,14+/m0/s1 |
| InChIKey | GKMPUDJJQYLNSA-UONOGXRCSA-N |
| XLogP | 3.53 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |