C28H33ClFN5O2S — CID 170030721
tert-butyl 4-[(1E,3Z)-1,4-diamino-4-(5-chloro-2-fluorophenyl)-2-(3-methanimidoylsulfanyl-4-methylanilino)buta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 170030721) has the molecular formula C28H33ClFN5O2S and a molecular weight of 558.12 g/mol. Its IUPAC name is tert-butyl 4-[(1E,3Z)-1,4-diamino-4-(5-chloro-2-fluorophenyl)-2-(3-methanimidoylsulfanyl-4-methylanilino)buta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1E,3Z)-1,4-diamino-4-(5-chloro-2-fluorophenyl)-2-(3-methanimidoylsulfanyl-4-methylanilino)buta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 170030721 |
| Molecular Formula | C28H33ClFN5O2S |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | tert-butyl 4-[(1E,3Z)-1,4-diamino-4-(5-chloro-2-fluorophenyl)-2-(3-methanimidoylsulfanyl-4-methylanilino)buta-1,3-dienyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [H]/N=C/Sc1cc(NC(/C=C(\N)c2cc(Cl)ccc2F)=C(/N)C2=CCN(C(=O)OC(C)(C)C)CC2)ccc1C |
| InChI | InChI=1S/C28H33ClFN5O2S/c1-17-5-7-20(14-25(17)38-16-31)34-24(15-23(32)21-13-19(29)6-8-22(21)30)26(33)18-9-11-35(12-10-18)27(36)37-28(2,3)4/h5-9,13-16,31,34H,10-12,32-33H2,1-4H3/b23-15-,26-24+,31-16+ |
| InChIKey | FVMOUFLDJPWGSN-UULHANDGSA-N |
| XLogP | 6.64 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|