C6H5FN4O2 — CID 170030859
8-fluoro-6-nitro-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 170030859) has the molecular formula C6H5FN4O2 and a molecular weight of 184.13 g/mol. Its IUPAC name is 8-fluoro-6-nitro-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-fluoro-6-nitro-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170030859 |
| Molecular Formula | C6H5FN4O2 |
| Molecular Weight | 184.13 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 8-fluoro-6-nitro-2,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | O=[N+]([O-])C1=CN2NCN=C2C(F)=C1 |
| InChI | InChI=1S/C6H5FN4O2/c7-5-1-4(11(12)13)2-10-6(5)8-3-9-10/h1-2,9H,3H2 |
| InChIKey | ILWXGBZYFPZMRZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.13 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|