C7H11FN4 — CID 170032463
8-fluoro-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 170032463) has the molecular formula C7H11FN4 and a molecular weight of 170.19 g/mol. Its IUPAC name is 8-fluoro-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | 8-fluoro-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 170032463 |
| Molecular Formula | C7H11FN4 |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.10 |
| IUPAC Name | 8-fluoro-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)CC(N)CC2F |
| InChI | InChI=1S/C7H11FN4/c1-4-10-7-6(8)2-5(9)3-12(7)11-4/h5-6H,2-3,9H2,1H3 |
| InChIKey | SNPIJIDLJLWCAI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |