About (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine
(Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine (PubChem CID 170033344) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine |
| PubChem CID | 170033344 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine |
| SMILES | C/C=C\N=C(\C=C(/N)c1ncccn1)C(C)(C)C |
| InChI | InChI=1S/C14H20N4/c1-5-7-16-12(14(2,3)4)10-11(15)13-17-8-6-9-18-13/h5-10H,15H2,1-4H3/b7-5-,11-10-,16-12- |
| InChIKey | ITGHWYKATDAODA-ZVZCBUTFSA-N |
| XLogP | 2.80 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine?
The IUPAC name of (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine (CID 170033344) is (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine.
What is the SMILES notation for (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine?
The canonical SMILES for (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine is C/C=C\N=C(\C=C(/N)c1ncccn1)C(C)(C)C.
What is the InChIKey of (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine?
The InChIKey is ITGHWYKATDAODA-ZVZCBUTFSA-N. The full InChI is InChI=1S/C14H20N4/c1-5-7-16-12(14(2,3)4)10-11(15)13-17-8-6-9-18-13/h5-10H,15H2,1-4H3/b7-5-,11-10-,16-12-.
What are the key properties of (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine?
(Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine has a molecular weight of 244.34 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,4-dimethyl-3-[(Z)-prop-1-enyl]imino-1-pyrimidin-2-ylpent-1-en-1-amine is sourced from PubChem (CID 170033344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).