C29H31F2N4O6PS — CID 170033404
[[2-[[(3S,6S,10aS)-5-oxo-3-(3-pyridin-3-ylazetidine-1-carbonyl)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid (PubChem CID 170033404) has the molecular formula C29H31F2N4O6PS and a molecular weight of 632.63 g/mol. Its IUPAC name is [[2-[[(3S,6S,10aS)-5-oxo-3-(3-pyridin-3-ylazetidine-1-carbonyl)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[2-[[(3S,6S,10aS)-5-oxo-3-(3-pyridin-3-ylazetidine-1-carbonyl)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 170033404 |
| Molecular Formula | C29H31F2N4O6PS |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | [[2-[[(3S,6S,10aS)-5-oxo-3-(3-pyridin-3-ylazetidine-1-carbonyl)-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-6-yl]carbamoyl]-1-benzothiophen-5-yl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(N[C@H]1CCCC[C@H]2CC[C@@H](C(=O)N3CC(c4cccnc4)C3)N2C1=O)c1cc2cc(C(F)(F)P(=O)(O)O)ccc2s1 |
| InChI | InChI=1S/C29H31F2N4O6PS/c30-29(31,42(39,40)41)20-7-10-24-18(12-20)13-25(43-24)26(36)33-22-6-2-1-5-21-8-9-23(35(21)27(22)37)28(38)34-15-19(16-34)17-4-3-11-32-14-17/h3-4,7,10-14,19,21-23H,1-2,5-6,8-9,15-16H2,(H,33,36)(H2,39,40,41)/t21-,22-,23-/m0/s1 |
| InChIKey | UBWPOKOXVZUKMB-VABKMULXSA-N |
| XLogP | 4.18 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|