C19H25F3N6O2 — CID 170034080
3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]piperidine-2,6-dione (PubChem CID 170034080) has the molecular formula C19H25F3N6O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170034080 |
| Molecular Formula | C19H25F3N6O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-6-fluoro-2-pyridinyl]amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(C4CCNCC4(F)F)CC3)c(F)n2)C(=O)N1 |
| InChI | InChI=1S/C19H25F3N6O2/c20-17-13(2-3-15(25-17)24-12-1-4-16(29)26-18(12)30)27-7-9-28(10-8-27)14-5-6-23-11-19(14,21)22/h2-3,12,14,23H,1,4-11H2,(H,24,25)(H,26,29,30) |
| InChIKey | GRKBSUJXANIJTR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|