C27H41N5O3 — CID 170035929
N-[1-cyclohexyl-2-[[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide (PubChem CID 170035929) has the molecular formula C27H41N5O3 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[1-cyclohexyl-2-[[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide.
| Compound Name | N-[1-cyclohexyl-2-[[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 170035929 |
| Molecular Formula | C27H41N5O3 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | N-[1-cyclohexyl-2-[[(2S)-3,3-dimethyl-1-oxo-1-[(1R,2R)-2,6,6-trimethyl-3-azabicyclo[3.1.0]hexan-3-yl]butan-2-yl]amino]-2-oxoethyl]pyrazine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H]2C(CN1C(=O)[C@@H](NC(=O)C(NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C27H41N5O3/c1-16-20-18(27(20,5)6)15-32(16)25(35)22(26(2,3)4)31-24(34)21(17-10-8-7-9-11-17)30-23(33)19-14-28-12-13-29-19/h12-14,16-18,20-22H,7-11,15H2,1-6H3,(H,30,33)(H,31,34)/t16-,18?,20-,21?,22-/m1/s1 |
| InChIKey | GTEXDMYQQXBDPS-VZLFSFRFSA-N |
| XLogP | 3.19 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |