C61H46O2 — CID 170036540
12-dibenzofuran-1-yl-4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene (PubChem CID 170036540) has the molecular formula C61H46O2 and a molecular weight of 811.04 g/mol. Its IUPAC name is 12-dibenzofuran-1-yl-4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene.
| Compound Name | 12-dibenzofuran-1-yl-4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 170036540 |
| Molecular Formula | C61H46O2 |
| Molecular Weight | 811.04 g/mol |
| Exact Mass | 810.35 |
| IUPAC Name | 12-dibenzofuran-1-yl-4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4ccc5c(c4)-c4cccc6c(-c7cccc8oc9ccccc9c78)ccc(c46)O5)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C61H46O2/c1-59(2,3)37-23-26-42-43-27-24-38(60(4,5)6)34-52(43)61(51(42)33-37)49-18-9-7-13-40(49)41-25-21-36(32-50(41)61)35-22-29-54-48(31-35)46-16-11-15-44-39(28-30-56(63-54)57(44)46)45-17-12-20-55-58(45)47-14-8-10-19-53(47)62-55/h7-34H,1-6H3 |
| InChIKey | QTYSMQHIKJQPLQ-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.04 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |