C22H24F4N4O3 — CID 170036608
(1R,2S,5S)-N-[(1S)-1-cyanopropyl]-3-[(2S)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170036608) has the molecular formula C22H24F4N4O3 and a molecular weight of 468.45 g/mol. Its IUPAC name is (1R,2S,5S)-N-[(1S)-1-cyanopropyl]-3-[(2S)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-[(1S)-1-cyanopropyl]-3-[(2S)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170036608 |
| Molecular Formula | C22H24F4N4O3 |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (1R,2S,5S)-N-[(1S)-1-cyanopropyl]-3-[(2S)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC[C@@H](C#N)NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)C(F)(F)F)c1ccc(F)cc1)C2(C)C |
| InChI | InChI=1S/C22H24F4N4O3/c1-4-13(9-27)28-18(31)17-15-14(21(15,2)3)10-30(17)19(32)16(29-20(33)22(24,25)26)11-5-7-12(23)8-6-11/h5-8,13-17H,4,10H2,1-3H3,(H,28,31)(H,29,33)/t13-,14-,15-,16-,17-/m0/s1 |
| InChIKey | XQLVAAJECUKBFN-WOYTXXSLSA-N |
| XLogP | 2.45 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |