C28H46N2O3S — CID 170036810
N-[(2S)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 170036810) has the molecular formula C28H46N2O3S and a molecular weight of 490.75 g/mol. Its IUPAC name is N-[(2S)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[(2S)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 170036810 |
| Molecular Formula | C28H46N2O3S |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | N-[(2S)-1-[(1S,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N[C@H](C(=O)N2C[C@@H]3[C@H](C2)C3(C)C)C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C28H46N2O3S/c1-16(2)19-12-20(17(3)4)24(21(13-19)18(5)6)34(32,33)29-25(27(7,8)9)26(31)30-14-22-23(15-30)28(22,10)11/h12-13,16-18,22-23,25,29H,14-15H2,1-11H3/t22-,23+,25-/m1/s1 |
| InChIKey | PZSKIXRZMCCLQE-GIFXNVAJSA-N |
| XLogP | 5.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |