C17H28N2 — CID 170036965
(2E,4E)-5,6-diethyl-N-ethylidene-N',2-dimethylnona-2,4,8-trienimidamide (PubChem CID 170036965) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (2E,4E)-5,6-diethyl-N-ethylidene-N',2-dimethylnona-2,4,8-trienimidamide.
| Compound Name | (2E,4E)-5,6-diethyl-N-ethylidene-N',2-dimethylnona-2,4,8-trienimidamide |
|---|---|
| PubChem CID | 170036965 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (2E,4E)-5,6-diethyl-N-ethylidene-N',2-dimethylnona-2,4,8-trienimidamide |
| SMILES | C=CCC(CC)/C(=C/C=C(C)/C(=N/C)/N=C/C)CC |
| InChI | InChI=1S/C17H28N2/c1-7-11-15(8-2)16(9-3)13-12-14(5)17(18-6)19-10-4/h7,10,12-13,15H,1,8-9,11H2,2-6H3/b14-12+,16-13+,18-17-,19-10+ |
| InChIKey | OBGRFUCXUNSFGX-IBVYIIHBSA-N |
| XLogP | 4.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|