C16H30N2 — CID 170037449
2,2,3-trimethyl-1,5,6-tri(propan-2-yl)pyrazine (PubChem CID 170037449) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 2,2,3-trimethyl-1,5,6-tri(propan-2-yl)pyrazine.
| Compound Name | 2,2,3-trimethyl-1,5,6-tri(propan-2-yl)pyrazine |
|---|---|
| PubChem CID | 170037449 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 2,2,3-trimethyl-1,5,6-tri(propan-2-yl)pyrazine |
| SMILES | CC1=NC(C(C)C)=C(C(C)C)N(C(C)C)C1(C)C |
| InChI | InChI=1S/C16H30N2/c1-10(2)14-15(11(3)4)18(12(5)6)16(8,9)13(7)17-14/h10-12H,1-9H3 |
| InChIKey | GCYRBHYKJUWBDO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |