C21H39NO — CID 170037483
3,3,4,4,5,5-hexamethyl-1,6,7-tri(propan-2-yl)azepin-2-one (PubChem CID 170037483) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexamethyl-1,6,7-tri(propan-2-yl)azepin-2-one.
| Compound Name | 3,3,4,4,5,5-hexamethyl-1,6,7-tri(propan-2-yl)azepin-2-one |
|---|---|
| PubChem CID | 170037483 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | 3,3,4,4,5,5-hexamethyl-1,6,7-tri(propan-2-yl)azepin-2-one |
| SMILES | CC(C)C1=C(C(C)C)C(C)(C)C(C)(C)C(C)(C)C(=O)N1C(C)C |
| InChI | InChI=1S/C21H39NO/c1-13(2)16-17(14(3)4)22(15(5)6)18(23)20(9,10)21(11,12)19(16,7)8/h13-15H,1-12H3 |
| InChIKey | NPWONKHPMMLPJX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |