C20N2O12 — CID 170037490
2,13-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),13,16(21)-pentaene-4,6,7,8,9,11,15,17,18,19,20,22-dodecone (PubChem CID 170037490) has the molecular formula C20N2O12 and a molecular weight of 460.22 g/mol. Its IUPAC name is 2,13-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),13,16(21)-pentaene-4,6,7,8,9,11,15,17,18,19,20,22-dodecone.
| Compound Name | 2,13-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),13,16(21)-pentaene-4,6,7,8,9,11,15,17,18,19,20,22-dodecone |
|---|---|
| PubChem CID | 170037490 |
| Molecular Formula | C20N2O12 |
| Molecular Weight | 460.22 g/mol |
| Exact Mass | 459.95 |
| IUPAC Name | 2,13-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3(12),5(10),13,16(21)-pentaene-4,6,7,8,9,11,15,17,18,19,20,22-dodecone |
| SMILES | O=c1c(=O)c(=O)c2c(=O)c3nc4c(=O)c5c(=O)c(=O)c(=O)c(=O)c5c(=O)c4nc3c(=O)c2c1=O |
| InChI | InChI=1S/C20N2O12/c23-9-1-2(14(28)18(32)17(31)13(1)27)10(24)6-5(9)21-7-8(22-6)12(26)4-3(11(7)25)15(29)19(33)20(34)16(4)30 |
| InChIKey | NZWQNDAZXISNPX-UHFFFAOYSA-N |
| XLogP | -5.96 |
| TPSA | 230.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.22 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|