C19H33NO — CID 170037507
3,4,5,5-tetramethyl-1,6,7-tri(propan-2-yl)azepin-2-one (PubChem CID 170037507) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is 3,4,5,5-tetramethyl-1,6,7-tri(propan-2-yl)azepin-2-one.
| Compound Name | 3,4,5,5-tetramethyl-1,6,7-tri(propan-2-yl)azepin-2-one |
|---|---|
| PubChem CID | 170037507 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | 3,4,5,5-tetramethyl-1,6,7-tri(propan-2-yl)azepin-2-one |
| SMILES | CC1=C(C)C(C)(C)C(C(C)C)=C(C(C)C)N(C(C)C)C1=O |
| InChI | InChI=1S/C19H33NO/c1-11(2)16-17(12(3)4)20(13(5)6)18(21)14(7)15(8)19(16,9)10/h11-13H,1-10H3 |
| InChIKey | PCEWHMAEUOMVQN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |