C13H21N3 — CID 170037842
N'-[(3E)-4-cyano-2,2-dimethylhexa-3,5-dien-3-yl]-N,N-dimethylethanimidamide (PubChem CID 170037842) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N'-[(3E)-4-cyano-2,2-dimethylhexa-3,5-dien-3-yl]-N,N-dimethylethanimidamide.
| Compound Name | N'-[(3E)-4-cyano-2,2-dimethylhexa-3,5-dien-3-yl]-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 170037842 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N'-[(3E)-4-cyano-2,2-dimethylhexa-3,5-dien-3-yl]-N,N-dimethylethanimidamide |
| SMILES | C=C/C(C#N)=C(\N=C(/C)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H21N3/c1-8-11(9-14)12(13(3,4)5)15-10(2)16(6)7/h8H,1H2,2-7H3/b12-11+,15-10+ |
| InChIKey | VEMRRBKNRRIAIP-LNXXMCPBSA-N |
| XLogP | 2.98 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|